C17H18BrNO5 — CID 17493489
3-bromo-N-(3,4-dimethoxyphenyl)-2,5-dimethoxybenzamide (PubChem CID 17493489) has the molecular formula C17H18BrNO5 and a molecular weight of 396.24 g/mol. Its IUPAC name is 3-bromo-N-(3,4-dimethoxyphenyl)-2,5-dimethoxybenzamide.
| Compound Name | 3-bromo-N-(3,4-dimethoxyphenyl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 17493489 |
| Molecular Formula | C17H18BrNO5 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 3-bromo-N-(3,4-dimethoxyphenyl)-2,5-dimethoxybenzamide |
| SMILES | COc1cc(Br)c(OC)c(C(=O)Nc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H18BrNO5/c1-21-11-8-12(16(24-4)13(18)9-11)17(20)19-10-5-6-14(22-2)15(7-10)23-3/h5-9H,1-4H3,(H,19,20) |
| InChIKey | QKAQTFGPNAWZLY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |