C10H12BrNO4 — CID 60713137
3-bromo-N,2,5-trimethoxybenzamide (PubChem CID 60713137) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is 3-bromo-N,2,5-trimethoxybenzamide.
| Compound Name | 3-bromo-N,2,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 60713137 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-bromo-N,2,5-trimethoxybenzamide |
| SMILES | CONC(=O)c1cc(OC)cc(Br)c1OC |
| InChI | InChI=1S/C10H12BrNO4/c1-14-6-4-7(10(13)12-16-3)9(15-2)8(11)5-6/h4-5H,1-3H3,(H,12,13) |
| InChIKey | RJYIJKCOHQOECU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|