C12H16BrNO4 — CID 79027472
3-bromo-N-[(2R)-1-hydroxypropan-2-yl]-2,5-dimethoxybenzamide (PubChem CID 79027472) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is 3-bromo-N-[(2R)-1-hydroxypropan-2-yl]-2,5-dimethoxybenzamide.
| Compound Name | 3-bromo-N-[(2R)-1-hydroxypropan-2-yl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 79027472 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 3-bromo-N-[(2R)-1-hydroxypropan-2-yl]-2,5-dimethoxybenzamide |
| SMILES | COc1cc(Br)c(OC)c(C(=O)N[C@H](C)CO)c1 |
| InChI | InChI=1S/C12H16BrNO4/c1-7(6-15)14-12(16)9-4-8(17-2)5-10(13)11(9)18-3/h4-5,7,15H,6H2,1-3H3,(H,14,16)/t7-/m1/s1 |
| InChIKey | GUVGWOFOJYTJCA-SSDOTTSWSA-N |
| XLogP | 1.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |