C13H18BrNO4 — CID 106843728
3-bromo-N-(4-hydroxybutyl)-2,5-dimethoxybenzamide (PubChem CID 106843728) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 3-bromo-N-(4-hydroxybutyl)-2,5-dimethoxybenzamide.
| Compound Name | 3-bromo-N-(4-hydroxybutyl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 106843728 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-bromo-N-(4-hydroxybutyl)-2,5-dimethoxybenzamide |
| SMILES | COc1cc(Br)c(OC)c(C(=O)NCCCCO)c1 |
| InChI | InChI=1S/C13H18BrNO4/c1-18-9-7-10(12(19-2)11(14)8-9)13(17)15-5-3-4-6-16/h7-8,16H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | MUPMXUTVZNEWIS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|