C9H9BrFNO3 — CID 164892762
3-bromo-5-fluoro-N,2-dimethoxybenzamide (PubChem CID 164892762) has the molecular formula C9H9BrFNO3 and a molecular weight of 278.08 g/mol. Its IUPAC name is 3-bromo-5-fluoro-N,2-dimethoxybenzamide.
| Compound Name | 3-bromo-5-fluoro-N,2-dimethoxybenzamide |
|---|---|
| PubChem CID | 164892762 |
| Molecular Formula | C9H9BrFNO3 |
| Molecular Weight | 278.08 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 3-bromo-5-fluoro-N,2-dimethoxybenzamide |
| SMILES | CONC(=O)c1cc(F)cc(Br)c1OC |
| InChI | InChI=1S/C9H9BrFNO3/c1-14-8-6(9(13)12-15-2)3-5(11)4-7(8)10/h3-4H,1-2H3,(H,12,13) |
| InChIKey | XGDFNXRDCSOHTE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.08 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|