C8H7Br2NO2 — CID 28665425
3,5-dibromo-2-methoxybenzamide (PubChem CID 28665425) has the molecular formula C8H7Br2NO2 and a molecular weight of 308.96 g/mol. Its IUPAC name is 3,5-dibromo-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-2-methoxybenzamide |
|---|---|
| PubChem CID | 28665425 |
| Molecular Formula | C8H7Br2NO2 |
| Molecular Weight | 308.96 g/mol |
| Exact Mass | 306.88 |
| IUPAC Name | 3,5-dibromo-2-methoxybenzamide |
| SMILES | COc1c(Br)cc(Br)cc1C(N)=O |
| InChI | InChI=1S/C8H7Br2NO2/c1-13-7-5(8(11)12)2-4(9)3-6(7)10/h2-3H,1H3,(H2,11,12) |
| InChIKey | QXBSMIREDHYMFV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.96 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |