C10H11Br2NO2 — CID 50850191
3,5-dibromo-2-methoxy-N,N-dimethylbenzamide (PubChem CID 50850191) has the molecular formula C10H11Br2NO2 and a molecular weight of 337.01 g/mol. Its IUPAC name is 3,5-dibromo-2-methoxy-N,N-dimethylbenzamide.
| Compound Name | 3,5-dibromo-2-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 50850191 |
| Molecular Formula | C10H11Br2NO2 |
| Molecular Weight | 337.01 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 3,5-dibromo-2-methoxy-N,N-dimethylbenzamide |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)N(C)C |
| InChI | InChI=1S/C10H11Br2NO2/c1-13(2)10(14)7-4-6(11)5-8(12)9(7)15-3/h4-5H,1-3H3 |
| InChIKey | RUCWDOVCQJWJMA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.01 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |