C9H5N3S — CID 118487331
N-(3,4-dicyanophenyl)methanethioamide (PubChem CID 118487331) has the molecular formula C9H5N3S and a molecular weight of 187.23 g/mol. Its IUPAC name is N-(3,4-dicyanophenyl)methanethioamide.
| Compound Name | N-(3,4-dicyanophenyl)methanethioamide |
|---|---|
| PubChem CID | 118487331 |
| Molecular Formula | C9H5N3S |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | N-(3,4-dicyanophenyl)methanethioamide |
| SMILES | N#Cc1ccc(NC=S)cc1C#N |
| InChI | InChI=1S/C9H5N3S/c10-4-7-1-2-9(12-6-13)3-8(7)5-11/h1-3,6H,(H,12,13) |
| InChIKey | DSXUSBHUWYVVSU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|