C13H14N4O — CID 114001769
2-(3,4-dicyanoanilino)-N,N-dimethylpropanamide (PubChem CID 114001769) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(3,4-dicyanoanilino)-N,N-dimethylpropanamide.
| Compound Name | 2-(3,4-dicyanoanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 114001769 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(3,4-dicyanoanilino)-N,N-dimethylpropanamide |
| SMILES | CC(Nc1ccc(C#N)c(C#N)c1)C(=O)N(C)C |
| InChI | InChI=1S/C13H14N4O/c1-9(13(18)17(2)3)16-12-5-4-10(7-14)11(6-12)8-15/h4-6,9,16H,1-3H3 |
| InChIKey | GWPZNRUDZHWGKZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |