C14H15N5O2 — CID 107789245
2-(3,4-dicyanoanilino)-N-(ethylcarbamoyl)propanamide (PubChem CID 107789245) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-(3,4-dicyanoanilino)-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-(3,4-dicyanoanilino)-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 107789245 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(3,4-dicyanoanilino)-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C14H15N5O2/c1-3-17-14(21)19-13(20)9(2)18-12-5-4-10(7-15)11(6-12)8-16/h4-6,9,18H,3H2,1-2H3,(H2,17,19,20,21) |
| InChIKey | TZHPLDZSVMPKLI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |