C13H16N2O — CID 43116515
2-(3-ethynylanilino)-N,N-dimethylpropanamide (PubChem CID 43116515) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(3-ethynylanilino)-N,N-dimethylpropanamide.
| Compound Name | 2-(3-ethynylanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43116515 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-(3-ethynylanilino)-N,N-dimethylpropanamide |
| SMILES | C#Cc1cccc(NC(C)C(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H16N2O/c1-5-11-7-6-8-12(9-11)14-10(2)13(16)15(3)4/h1,6-10,14H,2-4H3 |
| InChIKey | XIOGVKZWDSUSLG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|