About N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide
N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide (PubChem CID 129132061) has the molecular formula C8H5F5N2S2
and a molecular weight of 288.27 g/mol. Its IUPAC name is N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide.
Molecular Properties
| Compound Name | N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide |
| PubChem CID | 129132061 |
| Molecular Formula | C8H5F5N2S2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide |
| SMILES | N#Cc1ccc(NC=S)cc1S(F)(F)(F)(F)F |
| InChI | InChI=1S/C8H5F5N2S2/c9-17(10,11,12,13)8-3-7(15-5-16)2-1-6(8)4-14/h1-3,5H,(H,15,16) |
| InChIKey | GAKGOINXZBJSSB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide?
The IUPAC name of N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide (CID 129132061) is N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide.
What is the SMILES notation for N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide?
The canonical SMILES for N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide is N#Cc1ccc(NC=S)cc1S(F)(F)(F)(F)F.
What is the InChIKey of N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide?
The InChIKey is GAKGOINXZBJSSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F5N2S2/c9-17(10,11,12,13)8-3-7(15-5-16)2-1-6(8)4-14/h1-3,5H,(H,15,16).
What are the key properties of N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide?
N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide has a molecular weight of 288.27 g/mol, XLogP of 4.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-cyano-3-(pentafluoro-λ6-sulfanyl)phenyl]methanethioamide is sourced from PubChem (CID 129132061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).