About 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile
4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile (PubChem CID 141385342) has the molecular formula C8H3F5N2S2
and a molecular weight of 286.25 g/mol. Its IUPAC name is 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile.
Molecular Properties
| Compound Name | 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile |
| PubChem CID | 141385342 |
| Molecular Formula | C8H3F5N2S2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile |
| SMILES | N#Cc1ccc(N=C=S)cc1S(F)(F)(F)(F)F |
| InChI | InChI=1S/C8H3F5N2S2/c9-17(10,11,12,13)8-3-7(15-5-16)2-1-6(8)4-14/h1-3H |
| InChIKey | HIDONYWOBJMGIW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile?
The IUPAC name of 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile (CID 141385342) is 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile.
What is the SMILES notation for 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile?
The canonical SMILES for 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile is N#Cc1ccc(N=C=S)cc1S(F)(F)(F)(F)F.
What is the InChIKey of 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile?
The InChIKey is HIDONYWOBJMGIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F5N2S2/c9-17(10,11,12,13)8-3-7(15-5-16)2-1-6(8)4-14/h1-3H.
What are the key properties of 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile?
4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile has a molecular weight of 286.25 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isothiocyanato-2-(pentafluoro-λ6-sulfanyl)benzonitrile is sourced from PubChem (CID 141385342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).