C11H12N2O2 — CID 169157316
N-(3-cyano-4-propan-2-yloxyphenyl)formamide (PubChem CID 169157316) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is N-(3-cyano-4-propan-2-yloxyphenyl)formamide.
| Compound Name | N-(3-cyano-4-propan-2-yloxyphenyl)formamide |
|---|---|
| PubChem CID | 169157316 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-(3-cyano-4-propan-2-yloxyphenyl)formamide |
| SMILES | CC(C)Oc1ccc(NC=O)cc1C#N |
| InChI | InChI=1S/C11H12N2O2/c1-8(2)15-11-4-3-10(13-7-14)5-9(11)6-12/h3-5,7-8H,1-2H3,(H,13,14) |
| InChIKey | YWWCIFIFBRNHAD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|