C15H17N5O2 — CID 86799894
1-(3-cyano-4-propan-2-yloxyphenyl)-3-(1-methylpyrazol-3-yl)urea (PubChem CID 86799894) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(3-cyano-4-propan-2-yloxyphenyl)-3-(1-methylpyrazol-3-yl)urea.
| Compound Name | 1-(3-cyano-4-propan-2-yloxyphenyl)-3-(1-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 86799894 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(3-cyano-4-propan-2-yloxyphenyl)-3-(1-methylpyrazol-3-yl)urea |
| SMILES | CC(C)Oc1ccc(NC(=O)Nc2ccn(C)n2)cc1C#N |
| InChI | InChI=1S/C15H17N5O2/c1-10(2)22-13-5-4-12(8-11(13)9-16)17-15(21)18-14-6-7-20(3)19-14/h4-8,10H,1-3H3,(H2,17,18,19,21) |
| InChIKey | DHOTWBOOAJVIKP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |