C13H11N3O3 — CID 107792663
3-(3,4-dicyanoanilino)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 107792663) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-(3,4-dicyanoanilino)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(3,4-dicyanoanilino)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 107792663 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-(3,4-dicyanoanilino)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C13H11N3O3/c1-13(2,12(18)19)11(17)16-10-4-3-8(6-14)9(5-10)7-15/h3-5H,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | BHSUDKUPFCRMKI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|