2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid

C12H14N2O5 — CID 82821763

IUPAC2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid
SMILESCc1cc(NC(=O)C(C)(C)C(=O)O)ccc1[N+](=O)[O-]
InChIInChI=1S/C12H14N2O5/c1-7-6-8(4-5-9(7)14(18)19)13-10(15)12(2,3)11(16)17/h4-6H,1-3H3,(H,13,15)(H,16,17)
InChIKeyHLKISPCGULJOBN-UHFFFAOYSA-N
MW266.25 g/mol
LogP1.95
Rot. Bonds4

About 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid

2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid (PubChem CID 82821763) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid.

Molecular Properties

Compound Name2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid
PubChem CID82821763
Molecular FormulaC12H14N2O5
Molecular Weight266.25 g/mol
Exact Mass266.09
IUPAC Name2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid
SMILESCc1cc(NC(=O)C(C)(C)C(=O)O)ccc1[N+](=O)[O-]
InChIInChI=1S/C12H14N2O5/c1-7-6-8(4-5-9(7)14(18)19)13-10(15)12(2,3)11(16)17/h4-6H,1-3H3,(H,13,15)(H,16,17)
InChIKeyHLKISPCGULJOBN-UHFFFAOYSA-N
XLogP1.95
TPSA109.54 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.25
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid?
The IUPAC name of 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid (CID 82821763) is 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid?
The canonical SMILES for 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid is Cc1cc(NC(=O)C(C)(C)C(=O)O)ccc1[N+](=O)[O-].
What is the InChIKey of 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid?
The InChIKey is HLKISPCGULJOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5/c1-7-6-8(4-5-9(7)14(18)19)13-10(15)12(2,3)11(16)17/h4-6H,1-3H3,(H,13,15)(H,16,17).
What are the key properties of 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid?
2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid has a molecular weight of 266.25 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(3-methyl-4-nitroanilino)-3-oxopropanoic acid is sourced from PubChem (CID 82821763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).