C11H11BrFNO3 — CID 82821308
3-(4-bromo-3-fluoroanilino)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 82821308) has the molecular formula C11H11BrFNO3 and a molecular weight of 304.12 g/mol. Its IUPAC name is 3-(4-bromo-3-fluoroanilino)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(4-bromo-3-fluoroanilino)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82821308 |
| Molecular Formula | C11H11BrFNO3 |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 3-(4-bromo-3-fluoroanilino)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C11H11BrFNO3/c1-11(2,10(16)17)9(15)14-6-3-4-7(12)8(13)5-6/h3-5H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | XCJSGTSDYRJEMR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|