C16H14Br2FNO3 — CID 59129777
(2S)-N-(4-bromo-3-fluorophenyl)-3-(4-bromophenoxy)-2-hydroxy-2-methylpropanamide (PubChem CID 59129777) has the molecular formula C16H14Br2FNO3 and a molecular weight of 447.10 g/mol. Its IUPAC name is (2S)-N-(4-bromo-3-fluorophenyl)-3-(4-bromophenoxy)-2-hydroxy-2-methylpropanamide.
| Compound Name | (2S)-N-(4-bromo-3-fluorophenyl)-3-(4-bromophenoxy)-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 59129777 |
| Molecular Formula | C16H14Br2FNO3 |
| Molecular Weight | 447.10 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | (2S)-N-(4-bromo-3-fluorophenyl)-3-(4-bromophenoxy)-2-hydroxy-2-methylpropanamide |
| SMILES | C[C@](O)(COc1ccc(Br)cc1)C(=O)Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C16H14Br2FNO3/c1-16(22,9-23-12-5-2-10(17)3-6-12)15(21)20-11-4-7-13(18)14(19)8-11/h2-8,22H,9H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | ABSJPVOYCKURQM-INIZCTEOSA-N |
| XLogP | 4.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.10 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |