C11H12BrFN2OS — CID 65435769
3-amino-N-(4-bromo-3-fluorophenyl)-2,2-dimethyl-3-sulfanylidenepropanamide (PubChem CID 65435769) has the molecular formula C11H12BrFN2OS and a molecular weight of 319.20 g/mol. Its IUPAC name is 3-amino-N-(4-bromo-3-fluorophenyl)-2,2-dimethyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(4-bromo-3-fluorophenyl)-2,2-dimethyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 65435769 |
| Molecular Formula | C11H12BrFN2OS |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 3-amino-N-(4-bromo-3-fluorophenyl)-2,2-dimethyl-3-sulfanylidenepropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(Br)c(F)c1)C(N)=S |
| InChI | InChI=1S/C11H12BrFN2OS/c1-11(2,9(14)17)10(16)15-6-3-4-7(12)8(13)5-6/h3-5H,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | AMUICUQRBAAIRC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|