C15H20BrFN2OS — CID 65437545
N-(4-bromo-3-fluorophenyl)-2-carbamothioyl-2-propylpentanamide (PubChem CID 65437545) has the molecular formula C15H20BrFN2OS and a molecular weight of 375.31 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-2-carbamothioyl-2-propylpentanamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-2-carbamothioyl-2-propylpentanamide |
|---|---|
| PubChem CID | 65437545 |
| Molecular Formula | C15H20BrFN2OS |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-2-carbamothioyl-2-propylpentanamide |
| SMILES | CCCC(CCC)(C(=O)Nc1ccc(Br)c(F)c1)C(N)=S |
| InChI | InChI=1S/C15H20BrFN2OS/c1-3-7-15(8-4-2,13(18)21)14(20)19-10-5-6-11(16)12(17)9-10/h5-6,9H,3-4,7-8H2,1-2H3,(H2,18,21)(H,19,20) |
| InChIKey | IJLUOJXAFHJUMN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|