C12H12N2O3 — CID 82820785
3-(3-cyanoanilino)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 82820785) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-(3-cyanoanilino)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(3-cyanoanilino)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82820785 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-(3-cyanoanilino)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C12H12N2O3/c1-12(2,11(16)17)10(15)14-9-5-3-4-8(6-9)7-13/h3-6H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | DZJHGIRBORGNLF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|