C15H19N3O3 — CID 65266203
3-[(3-cyanophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid (PubChem CID 65266203) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-[(3-cyanophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(3-cyanophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65266203 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-[(3-cyanophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(NC(=O)Nc1cccc(C#N)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C15H19N3O3/c1-14(2,12(19)20)15(3,4)18-13(21)17-11-7-5-6-10(8-11)9-16/h5-8H,1-4H3,(H,19,20)(H2,17,18,21) |
| InChIKey | LPAQEEQDDFBSBJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |