C12H15N3OS2 — CID 110445109
1,1-diethyl-3-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea (PubChem CID 110445109) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1,1-diethyl-3-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 110445109 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1,1-diethyl-3-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
| SMILES | CCN(CC)C(=O)Nc1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C12H15N3OS2/c1-3-15(4-2)11(16)13-8-5-6-9-10(7-8)18-12(17)14-9/h5-7H,3-4H2,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | UHFXVSDZUZIOCU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|