C18H20N4OS2 — CID 91060813
1-pentyl-3-pyridin-4-yl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea (PubChem CID 91060813) has the molecular formula C18H20N4OS2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-pentyl-3-pyridin-4-yl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-pentyl-3-pyridin-4-yl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 91060813 |
| Molecular Formula | C18H20N4OS2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-pentyl-3-pyridin-4-yl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
| SMILES | CCCCCN(C(=O)Nc1ccncc1)c1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C18H20N4OS2/c1-2-3-4-11-22(17(23)20-13-7-9-19-10-8-13)14-5-6-15-16(12-14)25-18(24)21-15/h5-10,12H,2-4,11H2,1H3,(H,21,24)(H,19,20,23) |
| InChIKey | SFNXJNRRIORVAF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|