C30H36N2O3S — CID 140500747
ethyl 2-[4-[3-[heptyl(phenylcarbamoyl)amino]phenyl]sulfanylphenyl]acetate (PubChem CID 140500747) has the molecular formula C30H36N2O3S and a molecular weight of 504.70 g/mol. Its IUPAC name is ethyl 2-[4-[3-[heptyl(phenylcarbamoyl)amino]phenyl]sulfanylphenyl]acetate.
| Compound Name | ethyl 2-[4-[3-[heptyl(phenylcarbamoyl)amino]phenyl]sulfanylphenyl]acetate |
|---|---|
| PubChem CID | 140500747 |
| Molecular Formula | C30H36N2O3S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | ethyl 2-[4-[3-[heptyl(phenylcarbamoyl)amino]phenyl]sulfanylphenyl]acetate |
| SMILES | CCCCCCCN(C(=O)Nc1ccccc1)c1cccc(Sc2ccc(CC(=O)OCC)cc2)c1 |
| InChI | InChI=1S/C30H36N2O3S/c1-3-5-6-7-11-21-32(30(34)31-25-13-9-8-10-14-25)26-15-12-16-28(23-26)36-27-19-17-24(18-20-27)22-29(33)35-4-2/h8-10,12-20,23H,3-7,11,21-22H2,1-2H3,(H,31,34) |
| InChIKey | VDFCQNNXNJPTBC-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|