C25H32N2O3S — CID 11743977
2-[4-[3-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl]acetic acid (PubChem CID 11743977) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is 2-[4-[3-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl]acetic acid.
| Compound Name | 2-[4-[3-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 11743977 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-[4-[3-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl]acetic acid |
| SMILES | C=CCNC(=O)N(CCCCCCC)c1cccc(Sc2ccc(CC(=O)O)cc2)c1 |
| InChI | InChI=1S/C25H32N2O3S/c1-3-5-6-7-8-17-27(25(30)26-16-4-2)21-10-9-11-23(19-21)31-22-14-12-20(13-15-22)18-24(28)29/h4,9-15,19H,2-3,5-8,16-18H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | LTMCRRHJCLJGBU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|