C25H32N2O3S — CID 91167950
[4-[3-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl] acetate (PubChem CID 91167950) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is [4-[3-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl] acetate.
| Compound Name | [4-[3-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl] acetate |
|---|---|
| PubChem CID | 91167950 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [4-[3-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl] acetate |
| SMILES | C=CCNC(=O)N(CCCCCCC)c1cccc(Sc2ccc(OC(C)=O)cc2)c1 |
| InChI | InChI=1S/C25H32N2O3S/c1-4-6-7-8-9-18-27(25(29)26-17-5-2)21-11-10-12-24(19-21)31-23-15-13-22(14-16-23)30-20(3)28/h5,10-16,19H,2,4,6-9,17-18H2,1,3H3,(H,26,29) |
| InChIKey | AEXWBJONPJLQIM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|