C27H36N2O3S — CID 140500717
ethyl 2-[4-[4-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl]acetate (PubChem CID 140500717) has the molecular formula C27H36N2O3S and a molecular weight of 468.66 g/mol. Its IUPAC name is ethyl 2-[4-[4-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl]acetate.
| Compound Name | ethyl 2-[4-[4-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl]acetate |
|---|---|
| PubChem CID | 140500717 |
| Molecular Formula | C27H36N2O3S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | ethyl 2-[4-[4-[heptyl(prop-2-enylcarbamoyl)amino]phenyl]sulfanylphenyl]acetate |
| SMILES | C=CCNC(=O)N(CCCCCCC)c1ccc(Sc2ccc(CC(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C27H36N2O3S/c1-4-7-8-9-10-20-29(27(31)28-19-5-2)23-13-17-25(18-14-23)33-24-15-11-22(12-16-24)21-26(30)32-6-3/h5,11-18H,2,4,6-10,19-21H2,1,3H3,(H,28,31) |
| InChIKey | UXESFQUYCKPPAG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|