C26H36N2O3S — CID 90862032
[4-[3-[butylcarbamoyl(heptyl)amino]phenyl]sulfanylphenyl] acetate (PubChem CID 90862032) has the molecular formula C26H36N2O3S and a molecular weight of 456.65 g/mol. Its IUPAC name is [4-[3-[butylcarbamoyl(heptyl)amino]phenyl]sulfanylphenyl] acetate.
| Compound Name | [4-[3-[butylcarbamoyl(heptyl)amino]phenyl]sulfanylphenyl] acetate |
|---|---|
| PubChem CID | 90862032 |
| Molecular Formula | C26H36N2O3S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | [4-[3-[butylcarbamoyl(heptyl)amino]phenyl]sulfanylphenyl] acetate |
| SMILES | CCCCCCCN(C(=O)NCCCC)c1cccc(Sc2ccc(OC(C)=O)cc2)c1 |
| InChI | InChI=1S/C26H36N2O3S/c1-4-6-8-9-10-19-28(26(30)27-18-7-5-2)22-12-11-13-25(20-22)32-24-16-14-23(15-17-24)31-21(3)29/h11-17,20H,4-10,18-19H2,1-3H3,(H,27,30) |
| InChIKey | MWHXLGWDQZAODE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|