C30H36N2O3S — CID 10391439
2-[3-[4-[hexylcarbamoyl(3-phenylpropyl)amino]phenyl]sulfanylphenyl]acetic acid (PubChem CID 10391439) has the molecular formula C30H36N2O3S and a molecular weight of 504.70 g/mol. Its IUPAC name is 2-[3-[4-[hexylcarbamoyl(3-phenylpropyl)amino]phenyl]sulfanylphenyl]acetic acid.
| Compound Name | 2-[3-[4-[hexylcarbamoyl(3-phenylpropyl)amino]phenyl]sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 10391439 |
| Molecular Formula | C30H36N2O3S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 2-[3-[4-[hexylcarbamoyl(3-phenylpropyl)amino]phenyl]sulfanylphenyl]acetic acid |
| SMILES | CCCCCCNC(=O)N(CCCc1ccccc1)c1ccc(Sc2cccc(CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C30H36N2O3S/c1-2-3-4-8-20-31-30(35)32(21-10-14-24-11-6-5-7-12-24)26-16-18-27(19-17-26)36-28-15-9-13-25(22-28)23-29(33)34/h5-7,9,11-13,15-19,22H,2-4,8,10,14,20-21,23H2,1H3,(H,31,35)(H,33,34) |
| InChIKey | XJIOIFXLJWSOBT-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|