C30H27N3O5S — CID 10370085
2-[4-[3-[(2-nitrophenyl)carbamoyl-(3-phenylpropyl)amino]phenyl]sulfanylphenyl]acetic acid (PubChem CID 10370085) has the molecular formula C30H27N3O5S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[4-[3-[(2-nitrophenyl)carbamoyl-(3-phenylpropyl)amino]phenyl]sulfanylphenyl]acetic acid.
| Compound Name | 2-[4-[3-[(2-nitrophenyl)carbamoyl-(3-phenylpropyl)amino]phenyl]sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 10370085 |
| Molecular Formula | C30H27N3O5S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2-[4-[3-[(2-nitrophenyl)carbamoyl-(3-phenylpropyl)amino]phenyl]sulfanylphenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Sc2cccc(N(CCCc3ccccc3)C(=O)Nc3ccccc3[N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H27N3O5S/c34-29(35)20-23-15-17-25(18-16-23)39-26-12-6-11-24(21-26)32(19-7-10-22-8-2-1-3-9-22)30(36)31-27-13-4-5-14-28(27)33(37)38/h1-6,8-9,11-18,21H,7,10,19-20H2,(H,31,36)(H,34,35) |
| InChIKey | NLTOKMLLVFKEKN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|