C31H29N3O5S — CID 154197880
ethyl 2-[4-[3-[[(2-nitrophenyl)-(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetate (PubChem CID 154197880) has the molecular formula C31H29N3O5S and a molecular weight of 555.66 g/mol. Its IUPAC name is ethyl 2-[4-[3-[[(2-nitrophenyl)-(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetate.
| Compound Name | ethyl 2-[4-[3-[[(2-nitrophenyl)-(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetate |
|---|---|
| PubChem CID | 154197880 |
| Molecular Formula | C31H29N3O5S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | ethyl 2-[4-[3-[[(2-nitrophenyl)-(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Sc2cccc(NC(=O)N(c3ccccc3[N+](=O)[O-])C(C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H29N3O5S/c1-3-39-30(35)20-23-16-18-26(19-17-23)40-27-13-9-12-25(21-27)32-31(36)33(22(2)24-10-5-4-6-11-24)28-14-7-8-15-29(28)34(37)38/h4-19,21-22H,3,20H2,1-2H3,(H,32,36) |
| InChIKey | PDFJNAPXPDIOJE-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|