C29H34N2O3S — CID 152763415
2-[3-[3-[[hexyl(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetic acid (PubChem CID 152763415) has the molecular formula C29H34N2O3S and a molecular weight of 490.67 g/mol. Its IUPAC name is 2-[3-[3-[[hexyl(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetic acid.
| Compound Name | 2-[3-[3-[[hexyl(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 152763415 |
| Molecular Formula | C29H34N2O3S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 2-[3-[3-[[hexyl(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetic acid |
| SMILES | CCCCCCN(C(=O)Nc1cccc(Sc2cccc(CC(=O)O)c2)c1)C(C)c1ccccc1 |
| InChI | InChI=1S/C29H34N2O3S/c1-3-4-5-9-18-31(22(2)24-13-7-6-8-14-24)29(34)30-25-15-11-17-27(21-25)35-26-16-10-12-23(19-26)20-28(32)33/h6-8,10-17,19,21-22H,3-5,9,18,20H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | OTJJXAGMNOHCRL-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|