C28H42N2O2 — CID 57290011
3-[2,6-di(propan-2-yl)phenyl]-1-heptyl-1-[1-(4-hydroxyphenyl)ethyl]urea (PubChem CID 57290011) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1-heptyl-1-[1-(4-hydroxyphenyl)ethyl]urea.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1-heptyl-1-[1-(4-hydroxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 57290011 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1-heptyl-1-[1-(4-hydroxyphenyl)ethyl]urea |
| SMILES | CCCCCCCN(C(=O)Nc1c(C(C)C)cccc1C(C)C)C(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C28H42N2O2/c1-7-8-9-10-11-19-30(22(6)23-15-17-24(31)18-16-23)28(32)29-27-25(20(2)3)13-12-14-26(27)21(4)5/h12-18,20-22,31H,7-11,19H2,1-6H3,(H,29,32) |
| InChIKey | GSYQEEDEBJILDS-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|