C22H37NOS — CID 15817217
N-[2,6-di(propan-2-yl)phenyl]-2-octylsulfanylacetamide (PubChem CID 15817217) has the molecular formula C22H37NOS and a molecular weight of 363.61 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-octylsulfanylacetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-octylsulfanylacetamide |
|---|---|
| PubChem CID | 15817217 |
| Molecular Formula | C22H37NOS |
| Molecular Weight | 363.61 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-octylsulfanylacetamide |
| SMILES | CCCCCCCCSCC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C22H37NOS/c1-6-7-8-9-10-11-15-25-16-21(24)23-22-19(17(2)3)13-12-14-20(22)18(4)5/h12-14,17-18H,6-11,15-16H2,1-5H3,(H,23,24) |
| InChIKey | LIUJLFREBJBCJZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|