C23H40N2O3S — CID 10432503
1-decan-2-ylsulfonyl-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 10432503) has the molecular formula C23H40N2O3S and a molecular weight of 424.65 g/mol. Its IUPAC name is 1-decan-2-ylsulfonyl-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-decan-2-ylsulfonyl-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 10432503 |
| Molecular Formula | C23H40N2O3S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 1-decan-2-ylsulfonyl-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CCCCCCCCC(C)S(=O)(=O)NC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C23H40N2O3S/c1-7-8-9-10-11-12-14-19(6)29(27,28)25-23(26)24-22-20(17(2)3)15-13-16-21(22)18(4)5/h13,15-19H,7-12,14H2,1-6H3,(H2,24,25,26) |
| InChIKey | USMQNIYTZPKOQP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|