C19H33N3O3S — CID 10667693
1-[2,6-di(propan-2-yl)phenyl]-3-(hexylsulfamoyl)urea (PubChem CID 10667693) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(hexylsulfamoyl)urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(hexylsulfamoyl)urea |
|---|---|
| PubChem CID | 10667693 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(hexylsulfamoyl)urea |
| SMILES | CCCCCCNS(=O)(=O)NC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C19H33N3O3S/c1-6-7-8-9-13-20-26(24,25)22-19(23)21-18-16(14(2)3)11-10-12-17(18)15(4)5/h10-12,14-15,20H,6-9,13H2,1-5H3,(H2,21,22,23) |
| InChIKey | IYVPSRFATUKXLE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|