C29H52N4O2 — CID 22272724
3-[2,6-di(propan-2-yl)phenyl]-1-heptyl-1-[2-[4-(3-hydroxypropyl)piperazin-1-yl]ethyl]urea (PubChem CID 22272724) has the molecular formula C29H52N4O2 and a molecular weight of 488.76 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1-heptyl-1-[2-[4-(3-hydroxypropyl)piperazin-1-yl]ethyl]urea.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1-heptyl-1-[2-[4-(3-hydroxypropyl)piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 22272724 |
| Molecular Formula | C29H52N4O2 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.41 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1-heptyl-1-[2-[4-(3-hydroxypropyl)piperazin-1-yl]ethyl]urea |
| SMILES | CCCCCCCN(CCN1CCN(CCCO)CC1)C(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C29H52N4O2/c1-6-7-8-9-10-16-33(22-21-32-19-17-31(18-20-32)15-12-23-34)29(35)30-28-26(24(2)3)13-11-14-27(28)25(4)5/h11,13-14,24-25,34H,6-10,12,15-23H2,1-5H3,(H,30,35) |
| InChIKey | DEKHXHQYLBZFEP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|