C29H44N4O2 — CID 42701635
1-[[4-(dimethylamino)phenyl]methyl]-3-[2,6-di(propan-2-yl)phenyl]-1-(3-morpholin-4-ylpropyl)urea (PubChem CID 42701635) has the molecular formula C29H44N4O2 and a molecular weight of 480.70 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-[2,6-di(propan-2-yl)phenyl]-1-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[2,6-di(propan-2-yl)phenyl]-1-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 42701635 |
| Molecular Formula | C29H44N4O2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[2,6-di(propan-2-yl)phenyl]-1-(3-morpholin-4-ylpropyl)urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)N(CCCN1CCOCC1)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C29H44N4O2/c1-22(2)26-9-7-10-27(23(3)4)28(26)30-29(34)33(16-8-15-32-17-19-35-20-18-32)21-24-11-13-25(14-12-24)31(5)6/h7,9-14,22-23H,8,15-21H2,1-6H3,(H,30,34) |
| InChIKey | SMXQHNFTZRKKOY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|