C22H29BrN4O2 — CID 42706414
3-(2-bromophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(2-morpholin-4-ylethyl)urea (PubChem CID 42706414) has the molecular formula C22H29BrN4O2 and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(2-morpholin-4-ylethyl)urea.
| Compound Name | 3-(2-bromophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 42706414 |
| Molecular Formula | C22H29BrN4O2 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 3-(2-bromophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(2-morpholin-4-ylethyl)urea |
| SMILES | CN(C)c1ccc(CN(CCN2CCOCC2)C(=O)Nc2ccccc2Br)cc1 |
| InChI | InChI=1S/C22H29BrN4O2/c1-25(2)19-9-7-18(8-10-19)17-27(12-11-26-13-15-29-16-14-26)22(28)24-21-6-4-3-5-20(21)23/h3-10H,11-17H2,1-2H3,(H,24,28) |
| InChIKey | CZEPYWNIZBCABS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|