C23H28N4O2 — CID 42707836
1-[(1-methylpyrrol-2-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-naphthalen-1-ylurea (PubChem CID 42707836) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-[(1-methylpyrrol-2-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-naphthalen-1-ylurea.
| Compound Name | 1-[(1-methylpyrrol-2-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 42707836 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-[(1-methylpyrrol-2-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-naphthalen-1-ylurea |
| SMILES | Cn1cccc1CN(CCN1CCOCC1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C23H28N4O2/c1-25-11-5-8-20(25)18-27(13-12-26-14-16-29-17-15-26)23(28)24-22-10-4-7-19-6-2-3-9-21(19)22/h2-11H,12-18H2,1H3,(H,24,28) |
| InChIKey | IVYODYUSRSHQRR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |