C28H33N3O4 — CID 69242484
4-[[3-morpholin-4-ylpropyl(1-naphthalen-1-ylethylcarbamoyl)amino]methyl]benzoic acid (PubChem CID 69242484) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-[[3-morpholin-4-ylpropyl(1-naphthalen-1-ylethylcarbamoyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[3-morpholin-4-ylpropyl(1-naphthalen-1-ylethylcarbamoyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 69242484 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 4-[[3-morpholin-4-ylpropyl(1-naphthalen-1-ylethylcarbamoyl)amino]methyl]benzoic acid |
| SMILES | CC(NC(=O)N(CCCN1CCOCC1)Cc1ccc(C(=O)O)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H33N3O4/c1-21(25-9-4-7-23-6-2-3-8-26(23)25)29-28(34)31(15-5-14-30-16-18-35-19-17-30)20-22-10-12-24(13-11-22)27(32)33/h2-4,6-13,21H,5,14-20H2,1H3,(H,29,34)(H,32,33) |
| InChIKey | ZJBRKQGWBFAKIS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |