C32H43N3O4 — CID 69240666
1-[[4-(diethoxymethyl)phenyl]methyl]-1-(3-morpholin-4-ylpropyl)-3-(1-naphthalen-1-ylethyl)urea (PubChem CID 69240666) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is 1-[[4-(diethoxymethyl)phenyl]methyl]-1-(3-morpholin-4-ylpropyl)-3-(1-naphthalen-1-ylethyl)urea.
| Compound Name | 1-[[4-(diethoxymethyl)phenyl]methyl]-1-(3-morpholin-4-ylpropyl)-3-(1-naphthalen-1-ylethyl)urea |
|---|---|
| PubChem CID | 69240666 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | 1-[[4-(diethoxymethyl)phenyl]methyl]-1-(3-morpholin-4-ylpropyl)-3-(1-naphthalen-1-ylethyl)urea |
| SMILES | CCOC(OCC)c1ccc(CN(CCCN2CCOCC2)C(=O)NC(C)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C32H43N3O4/c1-4-38-31(39-5-2)28-16-14-26(15-17-28)24-35(19-9-18-34-20-22-37-23-21-34)32(36)33-25(3)29-13-8-11-27-10-6-7-12-30(27)29/h6-8,10-17,25,31H,4-5,9,18-24H2,1-3H3,(H,33,36) |
| InChIKey | URKXGKILQSGSLO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|