C22H27Cl3N2O2 — CID 57103881
1-heptyl-1-[1-(4-hydroxyphenyl)ethyl]-3-(2,4,6-trichlorophenyl)urea (PubChem CID 57103881) has the molecular formula C22H27Cl3N2O2 and a molecular weight of 457.83 g/mol. Its IUPAC name is 1-heptyl-1-[1-(4-hydroxyphenyl)ethyl]-3-(2,4,6-trichlorophenyl)urea.
| Compound Name | 1-heptyl-1-[1-(4-hydroxyphenyl)ethyl]-3-(2,4,6-trichlorophenyl)urea |
|---|---|
| PubChem CID | 57103881 |
| Molecular Formula | C22H27Cl3N2O2 |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-heptyl-1-[1-(4-hydroxyphenyl)ethyl]-3-(2,4,6-trichlorophenyl)urea |
| SMILES | CCCCCCCN(C(=O)Nc1c(Cl)cc(Cl)cc1Cl)C(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H27Cl3N2O2/c1-3-4-5-6-7-12-27(15(2)16-8-10-18(28)11-9-16)22(29)26-21-19(24)13-17(23)14-20(21)25/h8-11,13-15,28H,3-7,12H2,1-2H3,(H,26,29) |
| InChIKey | MJKOQBGUUVAZSY-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|