C14H18Cl3NO — CID 40563643
(2R)-2-ethyl-N-(2,4,6-trichlorophenyl)hexanamide (PubChem CID 40563643) has the molecular formula C14H18Cl3NO and a molecular weight of 322.66 g/mol. Its IUPAC name is (2R)-2-ethyl-N-(2,4,6-trichlorophenyl)hexanamide.
| Compound Name | (2R)-2-ethyl-N-(2,4,6-trichlorophenyl)hexanamide |
|---|---|
| PubChem CID | 40563643 |
| Molecular Formula | C14H18Cl3NO |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (2R)-2-ethyl-N-(2,4,6-trichlorophenyl)hexanamide |
| SMILES | CCCC[C@@H](CC)C(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl3NO/c1-3-5-6-9(4-2)14(19)18-13-11(16)7-10(15)8-12(13)17/h7-9H,3-6H2,1-2H3,(H,18,19)/t9-/m1/s1 |
| InChIKey | WCAPKGGLNRHZII-SECBINFHSA-N |
| XLogP | 5.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |