C25H35Cl2NO2 — CID 168944627
1,4-dichloro-2-methylbenzene;2-ethyl-N-[4-(hydroxymethyl)-2,6-dimethylphenyl]heptanamide (PubChem CID 168944627) has the molecular formula C25H35Cl2NO2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 1,4-dichloro-2-methylbenzene;2-ethyl-N-[4-(hydroxymethyl)-2,6-dimethylphenyl]heptanamide.
| Compound Name | 1,4-dichloro-2-methylbenzene;2-ethyl-N-[4-(hydroxymethyl)-2,6-dimethylphenyl]heptanamide |
|---|---|
| PubChem CID | 168944627 |
| Molecular Formula | C25H35Cl2NO2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1,4-dichloro-2-methylbenzene;2-ethyl-N-[4-(hydroxymethyl)-2,6-dimethylphenyl]heptanamide |
| SMILES | CCCCCC(CC)C(=O)Nc1c(C)cc(CO)cc1C.Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H29NO2.C7H6Cl2/c1-5-7-8-9-16(6-2)18(21)19-17-13(3)10-15(12-20)11-14(17)4;1-5-4-6(8)2-3-7(5)9/h10-11,16,20H,5-9,12H2,1-4H3,(H,19,21);2-4H,1H3 |
| InChIKey | FPYNZLHDQNOTBX-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|