C32H40N2O3S — CID 154161883
ethyl 2-[4-[3-[[heptyl(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetate (PubChem CID 154161883) has the molecular formula C32H40N2O3S and a molecular weight of 532.75 g/mol. Its IUPAC name is ethyl 2-[4-[3-[[heptyl(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetate.
| Compound Name | ethyl 2-[4-[3-[[heptyl(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetate |
|---|---|
| PubChem CID | 154161883 |
| Molecular Formula | C32H40N2O3S |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | ethyl 2-[4-[3-[[heptyl(1-phenylethyl)carbamoyl]amino]phenyl]sulfanylphenyl]acetate |
| SMILES | CCCCCCCN(C(=O)Nc1cccc(Sc2ccc(CC(=O)OCC)cc2)c1)C(C)c1ccccc1 |
| InChI | InChI=1S/C32H40N2O3S/c1-4-6-7-8-12-22-34(25(3)27-14-10-9-11-15-27)32(36)33-28-16-13-17-30(24-28)38-29-20-18-26(19-21-29)23-31(35)37-5-2/h9-11,13-21,24-25H,4-8,12,22-23H2,1-3H3,(H,33,36) |
| InChIKey | NWQRXMDGSZZVOV-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|