C31H38N2O3S — CID 140500692
ethyl 2-[4-[3-[hexylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl]acetate (PubChem CID 140500692) has the molecular formula C31H38N2O3S and a molecular weight of 518.72 g/mol. Its IUPAC name is ethyl 2-[4-[3-[hexylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl]acetate.
| Compound Name | ethyl 2-[4-[3-[hexylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl]acetate |
|---|---|
| PubChem CID | 140500692 |
| Molecular Formula | C31H38N2O3S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | ethyl 2-[4-[3-[hexylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl]acetate |
| SMILES | CCCCCCNC(=O)N(CCc1ccccc1)c1cccc(Sc2ccc(CC(=O)OCC)cc2)c1 |
| InChI | InChI=1S/C31H38N2O3S/c1-3-5-6-10-21-32-31(35)33(22-20-25-12-8-7-9-13-25)27-14-11-15-29(24-27)37-28-18-16-26(17-19-28)23-30(34)36-4-2/h7-9,11-19,24H,3-6,10,20-23H2,1-2H3,(H,32,35) |
| InChIKey | MSXANLCNTVPICO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|