C29H34N2O3S — CID 91237966
[4-[4-[butylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl] butanoate (PubChem CID 91237966) has the molecular formula C29H34N2O3S and a molecular weight of 490.67 g/mol. Its IUPAC name is [4-[4-[butylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl] butanoate.
| Compound Name | [4-[4-[butylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl] butanoate |
|---|---|
| PubChem CID | 91237966 |
| Molecular Formula | C29H34N2O3S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | [4-[4-[butylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl] butanoate |
| SMILES | CCCCNC(=O)N(CCc1ccccc1)c1ccc(Sc2ccc(OC(=O)CCC)cc2)cc1 |
| InChI | InChI=1S/C29H34N2O3S/c1-3-5-21-30-29(33)31(22-20-23-10-7-6-8-11-23)24-12-16-26(17-13-24)35-27-18-14-25(15-19-27)34-28(32)9-4-2/h6-8,10-19H,3-5,9,20-22H2,1-2H3,(H,30,33) |
| InChIKey | PAPGTZPOUUIYAT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|